C23H20FN3O4 — CID 135380839
2-ethoxy-4-[6-[2-(6-fluoro-1-benzofuran-5-yl)ethylamino]pyrimidin-4-yl]benzoic acid (PubChem CID 135380839) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-ethoxy-4-[6-[2-(6-fluoro-1-benzofuran-5-yl)ethylamino]pyrimidin-4-yl]benzoic acid.
| Compound Name | 2-ethoxy-4-[6-[2-(6-fluoro-1-benzofuran-5-yl)ethylamino]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 135380839 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-ethoxy-4-[6-[2-(6-fluoro-1-benzofuran-5-yl)ethylamino]pyrimidin-4-yl]benzoic acid |
| SMILES | CCOc1cc(-c2cc(NCCc3cc4ccoc4cc3F)ncn2)ccc1C(=O)O |
| InChI | InChI=1S/C23H20FN3O4/c1-2-30-21-10-15(3-4-17(21)23(28)29)19-12-22(27-13-26-19)25-7-5-14-9-16-6-8-31-20(16)11-18(14)24/h3-4,6,8-13H,2,5,7H2,1H3,(H,28,29)(H,25,26,27) |
| InChIKey | NNNAFIKSZZKLBH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |