C24H22FN5O — CID 135333256
N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-(1H-indol-5-yl)pyrimidin-4-amine (PubChem CID 135333256) has the molecular formula C24H22FN5O and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-(1H-indol-5-yl)pyrimidin-4-amine.
| Compound Name | N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-(1H-indol-5-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 135333256 |
| Molecular Formula | C24H22FN5O |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-(1H-indol-5-yl)pyrimidin-4-amine |
| SMILES | COc1ccc(F)c2c1cc(C)n2CCNc1cc(-c2ccc3[nH]ccc3c2)ncn1 |
| InChI | InChI=1S/C24H22FN5O/c1-15-11-18-22(31-2)6-4-19(25)24(18)30(15)10-9-27-23-13-21(28-14-29-23)16-3-5-20-17(12-16)7-8-26-20/h3-8,11-14,26H,9-10H2,1-2H3,(H,27,28,29) |
| InChIKey | NKVLAKQRBQZKJL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |