C25H22FN5O — CID 135333261
N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-quinolin-6-ylpyrimidin-4-amine (PubChem CID 135333261) has the molecular formula C25H22FN5O and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-quinolin-6-ylpyrimidin-4-amine.
| Compound Name | N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-quinolin-6-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 135333261 |
| Molecular Formula | C25H22FN5O |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | N-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethyl]-6-quinolin-6-ylpyrimidin-4-amine |
| SMILES | COc1ccc(F)c2c1cc(C)n2CCNc1cc(-c2ccc3ncccc3c2)ncn1 |
| InChI | InChI=1S/C25H22FN5O/c1-16-12-19-23(32-2)8-6-20(26)25(19)31(16)11-10-28-24-14-22(29-15-30-24)18-5-7-21-17(13-18)4-3-9-27-21/h3-9,12-15H,10-11H2,1-2H3,(H,28,29,30) |
| InChIKey | SARJDGXCJNUNIP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |