C23H30N2O7S — CID 135334284
2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[(3-methyl-4-nitrophenoxy)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-2-propan-2-yl-3H-1,3-thiazole-4-carboxylic acid (PubChem CID 135334284) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is 2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[(3-methyl-4-nitrophenoxy)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-2-propan-2-yl-3H-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[(3-methyl-4-nitrophenoxy)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-2-propan-2-yl-3H-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 135334284 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-[(2R,4aR,5S,6R,7aS)-6-hydroxy-5-[(3-methyl-4-nitrophenoxy)methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-2-propan-2-yl-3H-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(OC[C@@H]2[C@H]3CC[C@H](C4(C(C)C)NC(C(=O)O)=CS4)O[C@H]3C[C@H]2O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H30N2O7S/c1-12(2)23(24-17(11-33-23)22(27)28)21-7-5-15-16(19(26)9-20(15)32-21)10-31-14-4-6-18(25(29)30)13(3)8-14/h4,6,8,11-12,15-16,19-21,24,26H,5,7,9-10H2,1-3H3,(H,27,28)/t15-,16-,19-,20+,21-,23?/m1/s1 |
| InChIKey | OIFUVKWVVRAXLV-QFKIHDEPSA-N |
| XLogP | 3.44 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|