C3H2F2N2S — CID 135334488
3-(difluoromethyl)-1,2,4-thiadiazole (PubChem CID 135334488) has the molecular formula C3H2F2N2S and a molecular weight of 136.13 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,2,4-thiadiazole.
| Compound Name | 3-(difluoromethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 135334488 |
| Molecular Formula | C3H2F2N2S |
| Molecular Weight | 136.13 g/mol |
| Exact Mass | 135.99 |
| IUPAC Name | 3-(difluoromethyl)-1,2,4-thiadiazole |
| SMILES | FC(F)c1ncsn1 |
| InChI | InChI=1S/C3H2F2N2S/c4-2(5)3-6-1-8-7-3/h1-2H |
| InChIKey | TVSDSRGSUIRJSI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |