C39H58N2O23 — CID 135337605
[6-[bis[2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]amino]-6-oxohexyl]carbamic acid (PubChem CID 135337605) has the molecular formula C39H58N2O23 and a molecular weight of 922.88 g/mol. Its IUPAC name is [6-[bis[2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]amino]-6-oxohexyl]carbamic acid.
| Compound Name | [6-[bis[2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]amino]-6-oxohexyl]carbamic acid |
|---|---|
| PubChem CID | 135337605 |
| Molecular Formula | C39H58N2O23 |
| Molecular Weight | 922.88 g/mol |
| Exact Mass | 922.34 |
| IUPAC Name | [6-[bis[2-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyethyl]amino]-6-oxohexyl]carbamic acid |
| SMILES | CC(=O)OC[C@H]1O[C@H](OCCN(CCO[C@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)C(=O)CCCCCNC(=O)O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C39H58N2O23/c1-20(42)55-18-28-31(57-22(3)44)33(59-24(5)46)35(61-26(7)48)37(63-28)53-16-14-41(30(50)12-10-9-11-13-40-39(51)52)15-17-54-38-36(62-27(8)49)34(60-25(6)47)32(58-23(4)45)29(64-38)19-56-21(2)43/h28-29,31-38,40H,9-19H2,1-8H3,(H,51,52)/t28-,29-,31-,32-,33+,34+,35+,36+,37+,38+/m1/s1 |
| InChIKey | MAGXADYOWYJRES-BMEBYPRTSA-N |
| XLogP | -0.16 |
| TPSA | 316.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.88 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|