C15H19F4NO2 — CID 135337978
[5-fluoro-2-methoxy-4-[4-(trifluoromethyl)cyclohexyl]oxyphenyl]methanamine (PubChem CID 135337978) has the molecular formula C15H19F4NO2 and a molecular weight of 321.31 g/mol. Its IUPAC name is [5-fluoro-2-methoxy-4-[4-(trifluoromethyl)cyclohexyl]oxyphenyl]methanamine.
| Compound Name | [5-fluoro-2-methoxy-4-[4-(trifluoromethyl)cyclohexyl]oxyphenyl]methanamine |
|---|---|
| PubChem CID | 135337978 |
| Molecular Formula | C15H19F4NO2 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [5-fluoro-2-methoxy-4-[4-(trifluoromethyl)cyclohexyl]oxyphenyl]methanamine |
| SMILES | COc1cc(OC2CCC(C(F)(F)F)CC2)c(F)cc1CN |
| InChI | InChI=1S/C15H19F4NO2/c1-21-13-7-14(12(16)6-9(13)8-20)22-11-4-2-10(3-5-11)15(17,18)19/h6-7,10-11H,2-5,8,20H2,1H3 |
| InChIKey | DKRAVNSXPNHHNY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |