C21H28N2O3 — CID 135342751
trans-tert-butyl (1S,3S)-2-methyl-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]cyclopropane-1-carboxylate (PubChem CID 135342751) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is trans-tert-butyl (1S,3S)-2-methyl-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]cyclopropane-1-carboxylate.
| Compound Name | trans-tert-butyl (1S,3S)-2-methyl-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 135342751 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | trans-tert-butyl (1S,3S)-2-methyl-3-[1-(2-phenylmethoxyethyl)pyrazol-4-yl]cyclopropane-1-carboxylate |
| SMILES | CC1[C@H](C(=O)OC(C)(C)C)[C@H]1c1cnn(CCOCc2ccccc2)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-15-18(19(15)20(24)26-21(2,3)4)17-12-22-23(13-17)10-11-25-14-16-8-6-5-7-9-16/h5-9,12-13,15,18-19H,10-11,14H2,1-4H3/t15?,18-,19+/m1/s1 |
| InChIKey | CYTPLVCQOMLRGA-FWZRCDJUSA-N |
| XLogP | 3.79 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|