C21H20N6O — CID 135342819
N-[8-amino-6-(4-ethyl-3-pyridinyl)isoquinolin-3-yl]-2-(1H-pyrazol-5-yl)acetamide (PubChem CID 135342819) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[8-amino-6-(4-ethyl-3-pyridinyl)isoquinolin-3-yl]-2-(1H-pyrazol-5-yl)acetamide.
| Compound Name | N-[8-amino-6-(4-ethyl-3-pyridinyl)isoquinolin-3-yl]-2-(1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 135342819 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-[8-amino-6-(4-ethyl-3-pyridinyl)isoquinolin-3-yl]-2-(1H-pyrazol-5-yl)acetamide |
| SMILES | CCc1ccncc1-c1cc(N)c2cnc(NC(=O)Cc3ccn[nH]3)cc2c1 |
| InChI | InChI=1S/C21H20N6O/c1-2-13-3-5-23-11-17(13)14-7-15-9-20(24-12-18(15)19(22)8-14)26-21(28)10-16-4-6-25-27-16/h3-9,11-12H,2,10,22H2,1H3,(H,25,27)(H,24,26,28) |
| InChIKey | YMOMZTPOTDBMEJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|