C27H23N7O2 — CID 155478332
N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-(1-benzylpyrazol-4-yl)oxamide (PubChem CID 155478332) has the molecular formula C27H23N7O2 and a molecular weight of 477.53 g/mol. Its IUPAC name is N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-(1-benzylpyrazol-4-yl)oxamide.
| Compound Name | N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-(1-benzylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 155478332 |
| Molecular Formula | C27H23N7O2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-(1-benzylpyrazol-4-yl)oxamide |
| SMILES | Cc1ccncc1-c1cc(N)c2cnc(NC(=O)C(=O)Nc3cnn(Cc4ccccc4)c3)cc2c1 |
| InChI | InChI=1S/C27H23N7O2/c1-17-7-8-29-13-22(17)19-9-20-11-25(30-14-23(20)24(28)10-19)33-27(36)26(35)32-21-12-31-34(16-21)15-18-5-3-2-4-6-18/h2-14,16H,15,28H2,1H3,(H,32,35)(H,30,33,36) |
| InChIKey | VOWKUFRARYNTME-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|