C33H30N8O2 — CID 155477741
N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-[4-cyano-1-[1-(4-cyanophenyl)cyclopropyl]piperidin-4-yl]oxamide (PubChem CID 155477741) has the molecular formula C33H30N8O2 and a molecular weight of 570.66 g/mol. Its IUPAC name is N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-[4-cyano-1-[1-(4-cyanophenyl)cyclopropyl]piperidin-4-yl]oxamide.
| Compound Name | N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-[4-cyano-1-[1-(4-cyanophenyl)cyclopropyl]piperidin-4-yl]oxamide |
|---|---|
| PubChem CID | 155477741 |
| Molecular Formula | C33H30N8O2 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N'-[4-cyano-1-[1-(4-cyanophenyl)cyclopropyl]piperidin-4-yl]oxamide |
| SMILES | Cc1ccncc1-c1cc(N)c2cnc(NC(=O)C(=O)NC3(C#N)CCN(C4(c5ccc(C#N)cc5)CC4)CC3)cc2c1 |
| InChI | InChI=1S/C33H30N8O2/c1-21-6-11-37-18-26(21)23-14-24-16-29(38-19-27(24)28(36)15-23)39-30(42)31(43)40-32(20-35)9-12-41(13-10-32)33(7-8-33)25-4-2-22(17-34)3-5-25/h2-6,11,14-16,18-19H,7-10,12-13,36H2,1H3,(H,40,43)(H,38,39,42) |
| InChIKey | CTUXTOXUYWUTGR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|