C25H28N6O2 — CID 155478306
4-[2-[[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]amino]-2-oxoethylidene]-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 155478306) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-[2-[[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]amino]-2-oxoethylidene]-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-[2-[[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]amino]-2-oxoethylidene]-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 155478306 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-[2-[[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]amino]-2-oxoethylidene]-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | Cc1ccncc1-c1cc(N)c2cnc(NC(=O)C=C3CCN(C(=O)N(C)C)CC3)cc2c1 |
| InChI | InChI=1S/C25H28N6O2/c1-16-4-7-27-14-20(16)18-11-19-13-23(28-15-21(19)22(26)12-18)29-24(32)10-17-5-8-31(9-6-17)25(33)30(2)3/h4,7,10-15H,5-6,8-9,26H2,1-3H3,(H,28,29,32) |
| InChIKey | RUMDAPQZMGTFED-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|