C33H29N5O — CID 155478247
N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-cyclobutylidene-2-(3-phenylanilino)acetamide (PubChem CID 155478247) has the molecular formula C33H29N5O and a molecular weight of 511.63 g/mol. Its IUPAC name is N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-cyclobutylidene-2-(3-phenylanilino)acetamide.
| Compound Name | N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-cyclobutylidene-2-(3-phenylanilino)acetamide |
|---|---|
| PubChem CID | 155478247 |
| Molecular Formula | C33H29N5O |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | N-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-cyclobutylidene-2-(3-phenylanilino)acetamide |
| SMILES | Cc1ccncc1-c1cc(N)c2cnc(NC(=O)C(Nc3cccc(-c4ccccc4)c3)=C3CCC3)cc2c1 |
| InChI | InChI=1S/C33H29N5O/c1-21-13-14-35-19-28(21)25-15-26-18-31(36-20-29(26)30(34)17-25)38-33(39)32(23-9-5-10-23)37-27-12-6-11-24(16-27)22-7-3-2-4-8-22/h2-4,6-8,11-20,37H,5,9-10,34H2,1H3,(H,36,38,39) |
| InChIKey | WGDZONNCVVJKCC-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|