C23H22N6O2 — CID 155477728
N'-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N-[[(1S)-2-(cyanomethyl)cyclopropyl]methyl]oxamide (PubChem CID 155477728) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N'-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N-[[(1S)-2-(cyanomethyl)cyclopropyl]methyl]oxamide.
| Compound Name | N'-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N-[[(1S)-2-(cyanomethyl)cyclopropyl]methyl]oxamide |
|---|---|
| PubChem CID | 155477728 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N'-[8-amino-6-(4-methyl-3-pyridinyl)isoquinolin-3-yl]-N-[[(1S)-2-(cyanomethyl)cyclopropyl]methyl]oxamide |
| SMILES | Cc1ccncc1-c1cc(N)c2cnc(NC(=O)C(=O)NC[C@H]3CC3CC#N)cc2c1 |
| InChI | InChI=1S/C23H22N6O2/c1-13-3-5-26-11-18(13)15-7-16-9-21(27-12-19(16)20(25)8-15)29-23(31)22(30)28-10-17-6-14(17)2-4-24/h3,5,7-9,11-12,14,17H,2,6,10,25H2,1H3,(H,28,30)(H,27,29,31)/t14?,17-/m1/s1 |
| InChIKey | ODHKPDKJCAOCJQ-FBMWCMRBSA-N |
| XLogP | 2.79 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|