C18H15FN4O — CID 135343190
cis-(1S,2S)-N-(8-amino-6-pyridin-3-ylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide (PubChem CID 135343190) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is cis-(1S,2S)-N-(8-amino-6-pyridin-3-ylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-(8-amino-6-pyridin-3-ylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135343190 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | cis-(1S,2S)-N-(8-amino-6-pyridin-3-ylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide |
| SMILES | Nc1cc(-c2cccnc2)cc2cc(NC(=O)[C@@H]3C[C@@H]3F)ncc12 |
| InChI | InChI=1S/C18H15FN4O/c19-15-7-13(15)18(24)23-17-6-12-4-11(10-2-1-3-21-8-10)5-16(20)14(12)9-22-17/h1-6,8-9,13,15H,7,20H2,(H,22,23,24)/t13-,15+/m1/s1 |
| InChIKey | UTNJTQFGJJJJLA-HIFRSBDPSA-N |
| XLogP | 3.18 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|