C19H16FN3O — CID 159956287
cis-(1R,2R)-N-(8-amino-6-phenylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide (PubChem CID 159956287) has the molecular formula C19H16FN3O and a molecular weight of 321.36 g/mol. Its IUPAC name is cis-(1R,2R)-N-(8-amino-6-phenylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-(8-amino-6-phenylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 159956287 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | cis-(1R,2R)-N-(8-amino-6-phenylisoquinolin-3-yl)-2-fluorocyclopropane-1-carboxamide |
| SMILES | Nc1cc(-c2ccccc2)cc2cc(NC(=O)[C@H]3C[C@H]3F)ncc12 |
| InChI | InChI=1S/C19H16FN3O/c20-16-9-14(16)19(24)23-18-8-13-6-12(11-4-2-1-3-5-11)7-17(21)15(13)10-22-18/h1-8,10,14,16H,9,21H2,(H,22,23,24)/t14-,16+/m0/s1 |
| InChIKey | FUBDNRZBGQGJJV-GOEBONIOSA-N |
| XLogP | 3.78 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|