C22H20N4O2 — CID 158323167
cis-(1S,2S)-N-[8-amino-6-[2-(2-hydroxyethyl)phenyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide (PubChem CID 158323167) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is cis-(1S,2S)-N-[8-amino-6-[2-(2-hydroxyethyl)phenyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[8-amino-6-[2-(2-hydroxyethyl)phenyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 158323167 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | cis-(1S,2S)-N-[8-amino-6-[2-(2-hydroxyethyl)phenyl]isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
| SMILES | N#C[C@H]1C[C@@H]1C(=O)Nc1cc2cc(-c3ccccc3CCO)cc(N)c2cn1 |
| InChI | InChI=1S/C22H20N4O2/c23-11-16-8-18(16)22(28)26-21-10-15-7-14(9-20(24)19(15)12-25-21)17-4-2-1-3-13(17)5-6-27/h1-4,7,9-10,12,16,18,27H,5-6,8,24H2,(H,25,26,28)/t16-,18+/m1/s1 |
| InChIKey | NMJGBSZNOGGRHO-AEFFLSMTSA-N |
| XLogP | 3.12 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|