C22H17N5O — CID 140921627
N-[8-amino-6-(2-cyano-6-methylphenyl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide (PubChem CID 140921627) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[8-amino-6-(2-cyano-6-methylphenyl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide.
| Compound Name | N-[8-amino-6-(2-cyano-6-methylphenyl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140921627 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[8-amino-6-(2-cyano-6-methylphenyl)isoquinolin-3-yl]-2-cyanocyclopropane-1-carboxamide |
| SMILES | Cc1cccc(C#N)c1-c1cc(N)c2cnc(NC(=O)C3CC3C#N)cc2c1 |
| InChI | InChI=1S/C22H17N5O/c1-12-3-2-4-13(9-23)21(12)15-5-14-8-20(26-11-18(14)19(25)7-15)27-22(28)17-6-16(17)10-24/h2-5,7-8,11,16-17H,6,25H2,1H3,(H,26,27,28) |
| InChIKey | MQCZSSWKOOCSLM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|