C34H34ClN5O5 — CID 135344496
N-[8-[bis[(2,4-dimethoxyphenyl)methyl]amino]-6-chloro-2,7-naphthyridin-3-yl]-2-cyanobicyclo[3.1.0]hexane-6-carboxamide (PubChem CID 135344496) has the molecular formula C34H34ClN5O5 and a molecular weight of 628.13 g/mol. Its IUPAC name is N-[8-[bis[(2,4-dimethoxyphenyl)methyl]amino]-6-chloro-2,7-naphthyridin-3-yl]-2-cyanobicyclo[3.1.0]hexane-6-carboxamide.
| Compound Name | N-[8-[bis[(2,4-dimethoxyphenyl)methyl]amino]-6-chloro-2,7-naphthyridin-3-yl]-2-cyanobicyclo[3.1.0]hexane-6-carboxamide |
|---|---|
| PubChem CID | 135344496 |
| Molecular Formula | C34H34ClN5O5 |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | N-[8-[bis[(2,4-dimethoxyphenyl)methyl]amino]-6-chloro-2,7-naphthyridin-3-yl]-2-cyanobicyclo[3.1.0]hexane-6-carboxamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2nc(Cl)cc3cc(NC(=O)C4C5CCC(C#N)C54)ncc23)c(OC)c1 |
| InChI | InChI=1S/C34H34ClN5O5/c1-42-23-8-5-20(27(13-23)44-3)17-40(18-21-6-9-24(43-2)14-28(21)45-4)33-26-16-37-30(12-22(26)11-29(35)38-33)39-34(41)32-25-10-7-19(15-36)31(25)32/h5-6,8-9,11-14,16,19,25,31-32H,7,10,17-18H2,1-4H3,(H,37,39,41) |
| InChIKey | ALCOCDKBRGHDGA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|