C26H21N3O — CID 135347401
N-(3H-benzimidazol-5-ylmethyl)-2-(4-phenoxyphenyl)aniline (PubChem CID 135347401) has the molecular formula C26H21N3O and a molecular weight of 391.47 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-ylmethyl)-2-(4-phenoxyphenyl)aniline.
| Compound Name | N-(3H-benzimidazol-5-ylmethyl)-2-(4-phenoxyphenyl)aniline |
|---|---|
| PubChem CID | 135347401 |
| Molecular Formula | C26H21N3O |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-(3H-benzimidazol-5-ylmethyl)-2-(4-phenoxyphenyl)aniline |
| SMILES | c1ccc(Oc2ccc(-c3ccccc3NCc3ccc4nc[nH]c4c3)cc2)cc1 |
| InChI | InChI=1S/C26H21N3O/c1-2-6-21(7-3-1)30-22-13-11-20(12-14-22)23-8-4-5-9-24(23)27-17-19-10-15-25-26(16-19)29-18-28-25/h1-16,18,27H,17H2,(H,28,29) |
| InChIKey | LIWGZXKJHRCRHB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |