C18H17N5Y-2 — CID 59551873
[5-(3H-benzimidazol-5-ylmethylamino)quinolin-2-yl]azanide;carbanide;yttrium (PubChem CID 59551873) has the molecular formula C18H17N5Y-2 and a molecular weight of 392.28 g/mol. Its IUPAC name is [5-(3H-benzimidazol-5-ylmethylamino)quinolin-2-yl]azanide;carbanide;yttrium.
| Compound Name | [5-(3H-benzimidazol-5-ylmethylamino)quinolin-2-yl]azanide;carbanide;yttrium |
|---|---|
| PubChem CID | 59551873 |
| Molecular Formula | C18H17N5Y-2 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | [5-(3H-benzimidazol-5-ylmethylamino)quinolin-2-yl]azanide;carbanide;yttrium |
| SMILES | [CH3-].[NH-]c1ccc2c(NCc3ccc4nc[nH]c4c3)cccc2n1.[Y] |
| InChI | InChI=1S/C17H14N5.CH3.Y/c18-17-7-5-12-13(2-1-3-14(12)22-17)19-9-11-4-6-15-16(8-11)21-10-20-15;;/h1-8,10,19H,9H2,(H2-,18,20,21,22);1H3;/q2*-1; |
| InChIKey | KUIGSZMAUQLBSY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|