C12H10ClN5 — CID 88890559
N-(3H-benzimidazol-5-ylmethyl)-2-chloropyrimidin-4-amine (PubChem CID 88890559) has the molecular formula C12H10ClN5 and a molecular weight of 259.70 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-ylmethyl)-2-chloropyrimidin-4-amine.
| Compound Name | N-(3H-benzimidazol-5-ylmethyl)-2-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 88890559 |
| Molecular Formula | C12H10ClN5 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | N-(3H-benzimidazol-5-ylmethyl)-2-chloropyrimidin-4-amine |
| SMILES | Clc1nccc(NCc2ccc3nc[nH]c3c2)n1 |
| InChI | InChI=1S/C12H10ClN5/c13-12-14-4-3-11(18-12)15-6-8-1-2-9-10(5-8)17-7-16-9/h1-5,7H,6H2,(H,16,17)(H,14,15,18) |
| InChIKey | AWOOEZFFIPASNL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |