C24H29N5O3S — CID 135348450
N-[5-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-2-hydroxyphenyl]propane-1-sulfonamide (PubChem CID 135348450) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is N-[5-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-2-hydroxyphenyl]propane-1-sulfonamide.
| Compound Name | N-[5-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-2-hydroxyphenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 135348450 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[5-[2-amino-5-(4-piperazin-1-ylphenyl)-3-pyridinyl]-2-hydroxyphenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cc(-c2cc(-c3ccc(N4CCNCC4)cc3)cnc2N)ccc1O |
| InChI | InChI=1S/C24H29N5O3S/c1-2-13-33(31,32)28-22-15-18(5-8-23(22)30)21-14-19(16-27-24(21)25)17-3-6-20(7-4-17)29-11-9-26-10-12-29/h3-8,14-16,26,28,30H,2,9-13H2,1H3,(H2,25,27) |
| InChIKey | RVYNOQUUDOREOT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|