C24H23N5O2 — CID 166093249
5-[2-amino-5-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]isoindole-1,3-dione (PubChem CID 166093249) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 5-[2-amino-5-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]isoindole-1,3-dione.
| Compound Name | 5-[2-amino-5-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166093249 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-[2-amino-5-[4-(4-methylpiperazin-1-yl)phenyl]-3-pyridinyl]isoindole-1,3-dione |
| SMILES | CN1CCN(c2ccc(-c3cnc(N)c(-c4ccc5c(c4)C(=O)NC5=O)c3)cc2)CC1 |
| InChI | InChI=1S/C24H23N5O2/c1-28-8-10-29(11-9-28)18-5-2-15(3-6-18)17-13-20(22(25)26-14-17)16-4-7-19-21(12-16)24(31)27-23(19)30/h2-7,12-14H,8-11H2,1H3,(H2,25,26)(H,27,30,31) |
| InChIKey | BMCLWZXNXGPSMF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|