C25H27FN6O3 — CID 175814430
6-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one;formic acid (PubChem CID 175814430) has the molecular formula C25H27FN6O3 and a molecular weight of 478.53 g/mol. Its IUPAC name is 6-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one;formic acid.
| Compound Name | 6-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one;formic acid |
|---|---|
| PubChem CID | 175814430 |
| Molecular Formula | C25H27FN6O3 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 6-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one;formic acid |
| SMILES | CN1CCN(c2ccc(-c3cnc(N)c(-c4cc5c(cc4F)C(=O)NCC5)n3)cc2)CC1.O=CO |
| InChI | InChI=1S/C24H25FN6O.CH2O2/c1-30-8-10-31(11-9-30)17-4-2-15(3-5-17)21-14-28-23(26)22(29-21)19-12-16-6-7-27-24(32)18(16)13-20(19)25;2-1-3/h2-5,12-14H,6-11H2,1H3,(H2,26,28)(H,27,32);1H,(H,2,3) |
| InChIKey | YJLLFIIOTGQMRO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|