C23H23FN6O — CID 166093986
6-[2-amino-6-fluoro-5-(5-piperazin-1-yl-2-pyridinyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166093986) has the molecular formula C23H23FN6O and a molecular weight of 418.48 g/mol. Its IUPAC name is 6-[2-amino-6-fluoro-5-(5-piperazin-1-yl-2-pyridinyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-6-fluoro-5-(5-piperazin-1-yl-2-pyridinyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166093986 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 6-[2-amino-6-fluoro-5-(5-piperazin-1-yl-2-pyridinyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | Nc1nc(F)c(-c2ccc(N3CCNCC3)cn2)cc1-c1ccc2c(c1)CCNC2=O |
| InChI | InChI=1S/C23H23FN6O/c24-21-19(20-4-2-16(13-28-20)30-9-7-26-8-10-30)12-18(22(25)29-21)14-1-3-17-15(11-14)5-6-27-23(17)31/h1-4,11-13,26H,5-10H2,(H2,25,29)(H,27,31) |
| InChIKey | IKMYYRUMDOFOSB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|