C23H22FN3OS — CID 166094377
6-[2-amino-6-fluoro-5-(4-propan-2-ylsulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 166094377) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is 6-[2-amino-6-fluoro-5-(4-propan-2-ylsulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-[2-amino-6-fluoro-5-(4-propan-2-ylsulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 166094377 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-[2-amino-6-fluoro-5-(4-propan-2-ylsulfanylphenyl)-3-pyridinyl]-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | CC(C)Sc1ccc(-c2cc(-c3ccc4c(c3)CCNC4=O)c(N)nc2F)cc1 |
| InChI | InChI=1S/C23H22FN3OS/c1-13(2)29-17-6-3-14(4-7-17)19-12-20(22(25)27-21(19)24)15-5-8-18-16(11-15)9-10-26-23(18)28/h3-8,11-13H,9-10H2,1-2H3,(H2,25,27)(H,26,28) |
| InChIKey | IGVAKJDTXWTYKO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|