C5H11NO2S2 — CID 135350732
1,5,2-dithiazocane 1,1-dioxide (PubChem CID 135350732) has the molecular formula C5H11NO2S2 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1,5,2-dithiazocane 1,1-dioxide.
| Compound Name | 1,5,2-dithiazocane 1,1-dioxide |
|---|---|
| PubChem CID | 135350732 |
| Molecular Formula | C5H11NO2S2 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 1,5,2-dithiazocane 1,1-dioxide |
| SMILES | O=S1(=O)CCCSCCN1 |
| InChI | InChI=1S/C5H11NO2S2/c7-10(8)5-1-3-9-4-2-6-10/h6H,1-5H2 |
| InChIKey | RJEMVWVVXMYHDO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |