About benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone
benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone (PubChem CID 135351660) has the molecular formula C20H19N5O
and a molecular weight of 345.41 g/mol. Its IUPAC name is benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 135351660 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cc3cnccc3n3c2nc2ccccc23)CC1 |
| InChI | InChI=1S/C20H19N5O/c1-23-8-10-24(11-9-23)20(26)15-12-14-13-21-7-6-17(14)25-18-5-3-2-4-16(18)22-19(15)25/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | RTDIHLZYGZAVJK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone (CID 135351660) is benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone is CN1CCN(C(=O)c2cc3cnccc3n3c2nc2ccccc23)CC1.
What is the InChIKey of benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone?
The InChIKey is RTDIHLZYGZAVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5O/c1-23-8-10-24(11-9-23)20(26)15-12-14-13-21-7-6-17(14)25-18-5-3-2-4-16(18)22-19(15)25/h2-7,12-13H,8-11H2,1H3.
What are the key properties of benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone?
benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone has a molecular weight of 345.41 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzimidazolo[1,2-a][1,6]naphthyridin-6-yl-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 135351660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).