C20H21N7O — CID 122523487
N-methyl-4-(4-methylpiperazin-1-yl)-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide (PubChem CID 122523487) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is N-methyl-4-(4-methylpiperazin-1-yl)-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide.
| Compound Name | N-methyl-4-(4-methylpiperazin-1-yl)-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide |
|---|---|
| PubChem CID | 122523487 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-methyl-4-(4-methylpiperazin-1-yl)-1,3,5,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide |
| SMILES | CNC(=O)c1cc2cnc(N3CCN(C)CC3)nc2n2c1nc1ccccc12 |
| InChI | InChI=1S/C20H21N7O/c1-21-19(28)14-11-13-12-22-20(26-9-7-25(2)8-10-26)24-17(13)27-16-6-4-3-5-15(16)23-18(14)27/h3-6,11-12H,7-10H2,1-2H3,(H,21,28) |
| InChIKey | YCSXLSIJFXEGNW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |