C20H24N7O+ — CID 122676797
trimethyl-[2-[[9-(methylcarbamoyl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaen-4-yl]amino]ethyl]azanium (PubChem CID 122676797) has the molecular formula C20H24N7O+ and a molecular weight of 378.46 g/mol. Its IUPAC name is trimethyl-[2-[[9-(methylcarbamoyl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaen-4-yl]amino]ethyl]azanium.
| Compound Name | trimethyl-[2-[[9-(methylcarbamoyl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaen-4-yl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 122676797 |
| Molecular Formula | C20H24N7O+ |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | trimethyl-[2-[[9-(methylcarbamoyl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaen-4-yl]amino]ethyl]azanium |
| SMILES | CNC(=O)c1cc2ncc(NCC[N+](C)(C)C)nc2n2c1nc1ccccc12 |
| InChI | InChI=1S/C20H23N7O/c1-21-20(28)13-11-15-19(25-17(12-23-15)22-9-10-27(2,3)4)26-16-8-6-5-7-14(16)24-18(13)26/h5-8,11-12H,9-10H2,1-4H3,(H-,21,22,24,25,28)/p+1 |
| InChIKey | ASVXIKKGOCIZHY-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|