C20H18N8O — CID 122676795
4-(2-imidazol-1-ylethylamino)-N-methyl-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide (PubChem CID 122676795) has the molecular formula C20H18N8O and a molecular weight of 386.42 g/mol. Its IUPAC name is 4-(2-imidazol-1-ylethylamino)-N-methyl-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide.
| Compound Name | 4-(2-imidazol-1-ylethylamino)-N-methyl-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide |
|---|---|
| PubChem CID | 122676795 |
| Molecular Formula | C20H18N8O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4-(2-imidazol-1-ylethylamino)-N-methyl-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carboxamide |
| SMILES | CNC(=O)c1cc2ncc(NCCn3ccnc3)nc2n2c1nc1ccccc12 |
| InChI | InChI=1S/C20H18N8O/c1-21-20(29)13-10-15-19(28-16-5-3-2-4-14(16)25-18(13)28)26-17(11-24-15)23-7-9-27-8-6-22-12-27/h2-6,8,10-12H,7,9H2,1H3,(H,21,29)(H,23,26) |
| InChIKey | KBPLANCAUWVKMH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |