C19H22N4O2 — CID 110432657
methyl 2-[4-(4-imidazol-1-ylbutylamino)quinolin-2-yl]acetate (PubChem CID 110432657) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is methyl 2-[4-(4-imidazol-1-ylbutylamino)quinolin-2-yl]acetate.
| Compound Name | methyl 2-[4-(4-imidazol-1-ylbutylamino)quinolin-2-yl]acetate |
|---|---|
| PubChem CID | 110432657 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl 2-[4-(4-imidazol-1-ylbutylamino)quinolin-2-yl]acetate |
| SMILES | COC(=O)Cc1cc(NCCCCn2ccnc2)c2ccccc2n1 |
| InChI | InChI=1S/C19H22N4O2/c1-25-19(24)13-15-12-18(16-6-2-3-7-17(16)22-15)21-8-4-5-10-23-11-9-20-14-23/h2-3,6-7,9,11-12,14H,4-5,8,10,13H2,1H3,(H,21,22) |
| InChIKey | KVYDRNAYXQXSFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|