C17H18N6O — CID 139357347
4-[2-(dimethylamino)ethylamino]-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one (PubChem CID 139357347) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylamino]-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one.
| Compound Name | 4-[2-(dimethylamino)ethylamino]-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 139357347 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-[2-(dimethylamino)ethylamino]-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one |
| SMILES | CN(C)CCNc1ccc2[nH]c(=O)c3nc4ccccc4n3c2n1 |
| InChI | InChI=1S/C17H18N6O/c1-22(2)10-9-18-14-8-7-12-15(21-14)23-13-6-4-3-5-11(13)19-16(23)17(24)20-12/h3-8H,9-10H2,1-2H3,(H,18,21)(H,20,24) |
| InChIKey | RUEYOPQNBCDLBF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |