C18H24N6O2 — CID 150624086
N-[2-(dimethylamino)ethyl]-3-(2-methylpropyl)-7-oxo-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-4-carboxamide (PubChem CID 150624086) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-(2-methylpropyl)-7-oxo-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-(2-methylpropyl)-7-oxo-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 150624086 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-(2-methylpropyl)-7-oxo-2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene-4-carboxamide |
| SMILES | CC(C)Cc1c(C(=O)NCCN(C)C)nc2c(=O)[nH]c3cccnc3n12 |
| InChI | InChI=1S/C18H24N6O2/c1-11(2)10-13-14(17(25)20-8-9-23(3)4)22-16-18(26)21-12-6-5-7-19-15(12)24(13)16/h5-7,11H,8-10H2,1-4H3,(H,20,25)(H,21,26) |
| InChIKey | IWNCKMZNJVWCLR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |