C17H15N3O2 — CID 156863175
ethane;5H-quinoxalino[2,1-b]quinazoline-6,12-dione (PubChem CID 156863175) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is ethane;5H-quinoxalino[2,1-b]quinazoline-6,12-dione.
| Compound Name | ethane;5H-quinoxalino[2,1-b]quinazoline-6,12-dione |
|---|---|
| PubChem CID | 156863175 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethane;5H-quinoxalino[2,1-b]quinazoline-6,12-dione |
| SMILES | CC.O=c1[nH]c2ccccc2n2c(=O)c3ccccc3nc12 |
| InChI | InChI=1S/C15H9N3O2.C2H6/c19-14-13-16-10-6-2-1-5-9(10)15(20)18(13)12-8-4-3-7-11(12)17-14;1-2/h1-8H,(H,17,19);1-2H3 |
| InChIKey | LJJNJFSBTQSORY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|