C17H12N2O — CID 14666352
5-methylquinolino[2,1-b]quinazolin-12-one (PubChem CID 14666352) has the molecular formula C17H12N2O and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-methylquinolino[2,1-b]quinazolin-12-one.
| Compound Name | 5-methylquinolino[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 14666352 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-methylquinolino[2,1-b]quinazolin-12-one |
| SMILES | Cc1cc2nc3ccccc3c(=O)n2c2ccccc12 |
| InChI | InChI=1S/C17H12N2O/c1-11-10-16-18-14-8-4-2-7-13(14)17(20)19(16)15-9-5-3-6-12(11)15/h2-10H,1H3 |
| InChIKey | IKBIIAPNIZQEMK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|