C19H19N5O — CID 134096041
5-[2-(dimethylamino)ethylamino]quinazolino[2,1-b]quinazolin-12-one (PubChem CID 134096041) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethylamino]quinazolino[2,1-b]quinazolin-12-one.
| Compound Name | 5-[2-(dimethylamino)ethylamino]quinazolino[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 134096041 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-[2-(dimethylamino)ethylamino]quinazolino[2,1-b]quinazolin-12-one |
| SMILES | CN(C)CCNc1nc2nc3ccccc3c(=O)n2c2ccccc12 |
| InChI | InChI=1S/C19H19N5O/c1-23(2)12-11-20-17-14-8-4-6-10-16(14)24-18(25)13-7-3-5-9-15(13)21-19(24)22-17/h3-10H,11-12H2,1-2H3,(H,20,21,22) |
| InChIKey | PVUWQPADDGDCMD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|