C18H11N5OS — CID 11152144
5-(1,3-thiazol-2-ylamino)quinazolino[2,1-b]quinazolin-12-one (PubChem CID 11152144) has the molecular formula C18H11N5OS and a molecular weight of 345.39 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-ylamino)quinazolino[2,1-b]quinazolin-12-one.
| Compound Name | 5-(1,3-thiazol-2-ylamino)quinazolino[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 11152144 |
| Molecular Formula | C18H11N5OS |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 5-(1,3-thiazol-2-ylamino)quinazolino[2,1-b]quinazolin-12-one |
| SMILES | O=c1c2ccccc2nc2nc(Nc3nccs3)c3ccccc3n12 |
| InChI | InChI=1S/C18H11N5OS/c24-16-11-5-1-3-7-13(11)20-17-21-15(22-18-19-9-10-25-18)12-6-2-4-8-14(12)23(16)17/h1-10H,(H,19,20,21,22) |
| InChIKey | KXBQEVOJCIBIJT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|