C19H11F3N4O2S2 — CID 53308404
2-[4-oxo-3-(3,4,5-trifluorophenyl)quinazolin-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 53308404) has the molecular formula C19H11F3N4O2S2 and a molecular weight of 448.45 g/mol. Its IUPAC name is 2-[4-oxo-3-(3,4,5-trifluorophenyl)quinazolin-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-oxo-3-(3,4,5-trifluorophenyl)quinazolin-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 53308404 |
| Molecular Formula | C19H11F3N4O2S2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 2-[4-oxo-3-(3,4,5-trifluorophenyl)quinazolin-2-yl]sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1cc(F)c(F)c(F)c1)Nc1nccs1 |
| InChI | InChI=1S/C19H11F3N4O2S2/c20-12-7-10(8-13(21)16(12)22)26-17(28)11-3-1-2-4-14(11)24-19(26)30-9-15(27)25-18-23-5-6-29-18/h1-8H,9H2,(H,23,25,27) |
| InChIKey | UDKVOOWOPLZACA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|