C11H7N3OS — CID 102030654
3-(1,3-thiazol-2-yl)quinazolin-4-one (PubChem CID 102030654) has the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)quinazolin-4-one.
| Compound Name | 3-(1,3-thiazol-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 102030654 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1-c1nccs1 |
| InChI | InChI=1S/C11H7N3OS/c15-10-8-3-1-2-4-9(8)13-7-14(10)11-12-5-6-16-11/h1-7H |
| InChIKey | XXJSZBDHRLLKDU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |