C17H10N2O2S — CID 3561841
6-(1,3-thiazol-2-yl)benzo[d][2]benzazepine-5,7-dione (PubChem CID 3561841) has the molecular formula C17H10N2O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 6-(1,3-thiazol-2-yl)benzo[d][2]benzazepine-5,7-dione.
| Compound Name | 6-(1,3-thiazol-2-yl)benzo[d][2]benzazepine-5,7-dione |
|---|---|
| PubChem CID | 3561841 |
| Molecular Formula | C17H10N2O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 6-(1,3-thiazol-2-yl)benzo[d][2]benzazepine-5,7-dione |
| SMILES | O=c1c2ccccc2c2ccccc2c(=O)n1-c1nccs1 |
| InChI | InChI=1S/C17H10N2O2S/c20-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)16(21)19(15)17-18-9-10-22-17/h1-10H |
| InChIKey | KOLHBKNVYPUCHU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |