C20H12N3O4S- — CID 2390138
2-[[3-hydroxy-1-oxo-2-(1,3-thiazol-2-yl)isoquinolin-4-yl]methylideneamino]benzoate (PubChem CID 2390138) has the molecular formula C20H12N3O4S- and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[[3-hydroxy-1-oxo-2-(1,3-thiazol-2-yl)isoquinolin-4-yl]methylideneamino]benzoate.
| Compound Name | 2-[[3-hydroxy-1-oxo-2-(1,3-thiazol-2-yl)isoquinolin-4-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 2390138 |
| Molecular Formula | C20H12N3O4S- |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-[[3-hydroxy-1-oxo-2-(1,3-thiazol-2-yl)isoquinolin-4-yl]methylideneamino]benzoate |
| SMILES | O=C([O-])c1ccccc1/N=C/c1c(O)n(-c2nccs2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H13N3O4S/c24-17-13-6-2-1-5-12(13)15(18(25)23(17)20-21-9-10-28-20)11-22-16-8-4-3-7-14(16)19(26)27/h1-11,25H,(H,26,27)/p-1/b22-11+ |
| InChIKey | PYLBVQUROBSCAP-SSDVNMTOSA-M |
| XLogP | 2.27 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|