C19H23N5O — CID 91354060
ethane;8-(methylamino)-1,3,9,11-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5,8,10,12,14,16-octaen-18-one (PubChem CID 91354060) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is ethane;8-(methylamino)-1,3,9,11-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5,8,10,12,14,16-octaen-18-one.
| Compound Name | ethane;8-(methylamino)-1,3,9,11-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5,8,10,12,14,16-octaen-18-one |
|---|---|
| PubChem CID | 91354060 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | ethane;8-(methylamino)-1,3,9,11-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-2(7),3,5,8,10,12,14,16-octaen-18-one |
| SMILES | CC.CC.CNc1nc2nc3ccccc3c(=O)n2c2ncccc12 |
| InChI | InChI=1S/C15H11N5O.2C2H6/c1-16-12-10-6-4-8-17-13(10)20-14(21)9-5-2-3-7-11(9)18-15(20)19-12;2*1-2/h2-8H,1H3,(H,16,18,19);2*1-2H3 |
| InChIKey | OAOGPNHVVSGEHA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|