C22H24N6O2 — CID 118509929
N-methoxy-2-(4-methyl-1,4-diazepan-1-yl)benzimidazolo[1,2-a][1,8]naphthyridine-6-carboxamide (PubChem CID 118509929) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-methoxy-2-(4-methyl-1,4-diazepan-1-yl)benzimidazolo[1,2-a][1,8]naphthyridine-6-carboxamide.
| Compound Name | N-methoxy-2-(4-methyl-1,4-diazepan-1-yl)benzimidazolo[1,2-a][1,8]naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 118509929 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-methoxy-2-(4-methyl-1,4-diazepan-1-yl)benzimidazolo[1,2-a][1,8]naphthyridine-6-carboxamide |
| SMILES | CONC(=O)c1cc2ccc(N3CCCN(C)CC3)nc2n2c1nc1ccccc12 |
| InChI | InChI=1S/C22H24N6O2/c1-26-10-5-11-27(13-12-26)19-9-8-15-14-16(22(29)25-30-2)21-23-17-6-3-4-7-18(17)28(21)20(15)24-19/h3-4,6-9,14H,5,10-13H2,1-2H3,(H,25,29) |
| InChIKey | JGNLQNACDJEBBB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|