C20H22N6 — CID 139357378
4-methyl-9-(4-methyl-1,4-diazepan-1-yl)-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene (PubChem CID 139357378) has the molecular formula C20H22N6 and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-methyl-9-(4-methyl-1,4-diazepan-1-yl)-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene.
| Compound Name | 4-methyl-9-(4-methyl-1,4-diazepan-1-yl)-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene |
|---|---|
| PubChem CID | 139357378 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-methyl-9-(4-methyl-1,4-diazepan-1-yl)-1,3,8,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,8,10,12,14,16-octaene |
| SMILES | Cc1ccc2nc(N3CCCN(C)CC3)c3nc4ccccc4n3c2n1 |
| InChI | InChI=1S/C20H22N6/c1-14-8-9-16-18(21-14)26-17-7-4-3-6-15(17)22-20(26)19(23-16)25-11-5-10-24(2)12-13-25/h3-4,6-9H,5,10-13H2,1-2H3 |
| InChIKey | JDSGJQDRBJUFFI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |