C19H17N7 — CID 118509916
4-(4-methylpiperazin-1-yl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carbonitrile (PubChem CID 118509916) has the molecular formula C19H17N7 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carbonitrile.
| Compound Name | 4-(4-methylpiperazin-1-yl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carbonitrile |
|---|---|
| PubChem CID | 118509916 |
| Molecular Formula | C19H17N7 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-1,3,6,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,8,10,12,14,16-octaene-9-carbonitrile |
| SMILES | CN1CCN(c2cnc3cc(C#N)c4nc5ccccc5n4c3n2)CC1 |
| InChI | InChI=1S/C19H17N7/c1-24-6-8-25(9-7-24)17-12-21-15-10-13(11-20)18-22-14-4-2-3-5-16(14)26(18)19(15)23-17/h2-5,10,12H,6-9H2,1H3 |
| InChIKey | FGKAAKNVTYLKKW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |