C22H22IN5 — CID 90667029
2-(4,4-dimethylpiperazin-4-ium-1-yl)benzimidazolo[1,2-a]quinoline-6-carbonitrile iodide (PubChem CID 90667029) has the molecular formula C22H22IN5 and a molecular weight of 483.36 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperazin-4-ium-1-yl)benzimidazolo[1,2-a]quinoline-6-carbonitrile iodide.
| Compound Name | 2-(4,4-dimethylpiperazin-4-ium-1-yl)benzimidazolo[1,2-a]quinoline-6-carbonitrile iodide |
|---|---|
| PubChem CID | 90667029 |
| Molecular Formula | C22H22IN5 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-(4,4-dimethylpiperazin-4-ium-1-yl)benzimidazolo[1,2-a]quinoline-6-carbonitrile iodide |
| SMILES | C[N+]1(C)CCN(c2ccc3cc(C#N)c4nc5ccccc5n4c3c2)CC1.[I-] |
| InChI | InChI=1S/C22H22N5.HI/c1-27(2)11-9-25(10-12-27)18-8-7-16-13-17(15-23)22-24-19-5-3-4-6-20(19)26(22)21(16)14-18;/h3-8,13-14H,9-12H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GLRFNKLVGODICJ-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 44.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|