C25H22ClN5 — CID 1042673
16-[4-(4-chlorophenyl)piperazin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 1042673) has the molecular formula C25H22ClN5 and a molecular weight of 427.94 g/mol. Its IUPAC name is 16-[4-(4-chlorophenyl)piperazin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-[4-(4-chlorophenyl)piperazin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 1042673 |
| Molecular Formula | C25H22ClN5 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 16-[4-(4-chlorophenyl)piperazin-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | N#Cc1c2c(c(N3CCN(c4ccc(Cl)cc4)CC3)n3c1nc1ccccc13)CCC2 |
| InChI | InChI=1S/C25H22ClN5/c26-17-8-10-18(11-9-17)29-12-14-30(15-13-29)25-20-5-3-4-19(20)21(16-27)24-28-22-6-1-2-7-23(22)31(24)25/h1-2,6-11H,3-5,12-15H2 |
| InChIKey | CDXTXZMLCFQGPW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |