C26H25FN5+ — CID 4747564
16-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile (PubChem CID 4747564) has the molecular formula C26H25FN5+ and a molecular weight of 426.52 g/mol. Its IUPAC name is 16-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile.
| Compound Name | 16-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
|---|---|
| PubChem CID | 4747564 |
| Molecular Formula | C26H25FN5+ |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 16-[4-[(4-fluorophenyl)methyl]piperazin-4-ium-1-yl]-1,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaene-10-carbonitrile |
| SMILES | N#Cc1c2c(c(N3CC[NH+](Cc4ccc(F)cc4)CC3)n3c1nc1ccccc13)CCC2 |
| InChI | InChI=1S/C26H24FN5/c27-19-10-8-18(9-11-19)17-30-12-14-31(15-13-30)26-21-5-3-4-20(21)22(16-28)25-29-23-6-1-2-7-24(23)32(25)26/h1-2,6-11H,3-5,12-15,17H2/p+1 |
| InChIKey | HPPFNLZAMLZQAO-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |